C24H33N3O3 — CID 22849964
(Z)-2-aminooxy-7-cyclohexyl-8-imidazol-1-yl-9-phenylnon-6-enoic acid (PubChem CID 22849964) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (Z)-2-aminooxy-7-cyclohexyl-8-imidazol-1-yl-9-phenylnon-6-enoic acid.
| Compound Name | (Z)-2-aminooxy-7-cyclohexyl-8-imidazol-1-yl-9-phenylnon-6-enoic acid |
|---|---|
| PubChem CID | 22849964 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | (Z)-2-aminooxy-7-cyclohexyl-8-imidazol-1-yl-9-phenylnon-6-enoic acid |
| SMILES | NOC(CCC/C=C(/C1CCCCC1)C(Cc1ccccc1)n1ccnc1)C(=O)O |
| InChI | InChI=1S/C24H33N3O3/c25-30-23(24(28)29)14-8-7-13-21(20-11-5-2-6-12-20)22(27-16-15-26-18-27)17-19-9-3-1-4-10-19/h1,3-4,9-10,13,15-16,18,20,22-23H,2,5-8,11-12,14,17,25H2,(H,28,29)/b21-13- |
| InChIKey | KSLKGRHDOYAOCR-BKUYFWCQSA-N |
| XLogP | 4.69 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|