C17H23N3O2S2 — CID 22850910
4-amino-N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]benzenesulfonamide (PubChem CID 22850910) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-amino-N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22850910 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-amino-N-[2-[(5R,7S)-5,7-dimethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]ethyl]benzenesulfonamide |
| SMILES | C[C@@H]1Cc2ccsc2[C@H](C)N1CCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-12-11-14-7-10-23-17(14)13(2)20(12)9-8-19-24(21,22)16-5-3-15(18)4-6-16/h3-7,10,12-13,19H,8-9,11,18H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | PXVGBYVIAODISN-OLZOCXBDSA-N |
| XLogP | 2.62 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|