C20H28ClN3O4S2 — CID 67850786
N-[3-[(5R,7S)-7-methyl-5-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride (PubChem CID 67850786) has the molecular formula C20H28ClN3O4S2 and a molecular weight of 474.05 g/mol. Its IUPAC name is N-[3-[(5R,7S)-7-methyl-5-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-[(5R,7S)-7-methyl-5-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 67850786 |
| Molecular Formula | C20H28ClN3O4S2 |
| Molecular Weight | 474.05 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[3-[(5R,7S)-7-methyl-5-propyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]propyl]-4-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CCC[C@@H]1Cc2ccsc2[C@H](C)N1CCCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C20H27N3O4S2.ClH/c1-3-5-18-14-16-10-13-28-20(16)15(2)22(18)12-4-11-21-29(26,27)19-8-6-17(7-9-19)23(24)25;/h6-10,13,15,18,21H,3-5,11-12,14H2,1-2H3;1H/t15-,18+;/m0./s1 |
| InChIKey | XQJKDOWFZCYKGR-QVNYQEOOSA-N |
| XLogP | 4.53 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.05 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|