C12H16N6O — CID 22853448
(2S)-2-amino-3-[4-[[(5-amino-1H-1,2,4-triazol-3-yl)amino]methyl]phenyl]propanal (PubChem CID 22853448) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[(5-amino-1H-1,2,4-triazol-3-yl)amino]methyl]phenyl]propanal.
| Compound Name | (2S)-2-amino-3-[4-[[(5-amino-1H-1,2,4-triazol-3-yl)amino]methyl]phenyl]propanal |
|---|---|
| PubChem CID | 22853448 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S)-2-amino-3-[4-[[(5-amino-1H-1,2,4-triazol-3-yl)amino]methyl]phenyl]propanal |
| SMILES | Nc1nc(NCc2ccc(C[C@H](N)C=O)cc2)n[nH]1 |
| InChI | InChI=1S/C12H16N6O/c13-10(7-19)5-8-1-3-9(4-2-8)6-15-12-16-11(14)17-18-12/h1-4,7,10H,5-6,13H2,(H4,14,15,16,17,18)/t10-/m0/s1 |
| InChIKey | QIDCUKVXLNICRH-JTQLQIEISA-N |
| XLogP | 0.07 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|