C19H22N4O4S — CID 22856348
methyl 3-[(3R,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]propanoate (PubChem CID 22856348) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is methyl 3-[(3R,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]propanoate.
| Compound Name | methyl 3-[(3R,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 22856348 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | methyl 3-[(3R,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-2-oxopyrrolidin-3-yl]propanoate |
| SMILES | [H]/N=C(\N)c1cnc(-c2ccc(OC[C@@H]3C[C@@H](CCC(=O)OC)C(=O)N3)cc2)s1 |
| InChI | InChI=1S/C19H22N4O4S/c1-26-16(24)7-4-12-8-13(23-18(12)25)10-27-14-5-2-11(3-6-14)19-22-9-15(28-19)17(20)21/h2-3,5-6,9,12-13H,4,7-8,10H2,1H3,(H3,20,21)(H,23,25)/t12-,13+/m1/s1 |
| InChIKey | RXIMCKQKAWFDSQ-OLZOCXBDSA-N |
| XLogP | 1.93 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|