C21H26N4O5S — CID 22856504
methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-1-(2-methoxyethyl)-2-oxopyrrolidin-3-yl]acetate (PubChem CID 22856504) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-1-(2-methoxyethyl)-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-1-(2-methoxyethyl)-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22856504 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(5-carbamimidoyl-1,3-thiazol-2-yl)phenoxy]methyl]-1-(2-methoxyethyl)-2-oxopyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1cnc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3CCOC)cc2)s1 |
| InChI | InChI=1S/C21H26N4O5S/c1-28-8-7-25-15(9-14(21(25)27)10-18(26)29-2)12-30-16-5-3-13(4-6-16)20-24-11-17(31-20)19(22)23/h3-6,11,14-15H,7-10,12H2,1-2H3,(H3,22,23)/t14-,15-/m0/s1 |
| InChIKey | UBQWAWRDQAFBPU-GJZGRUSLSA-N |
| XLogP | 1.90 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|