C27H35N3O2 — CID 22865489
(4S,4aS)-3-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyl-1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-one (PubChem CID 22865489) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is (4S,4aS)-3-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyl-1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-one.
| Compound Name | (4S,4aS)-3-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyl-1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-one |
|---|---|
| PubChem CID | 22865489 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | (4S,4aS)-3-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-4-phenyl-1,4,4a,5,6,7,8,8a-octahydroquinazolin-2-one |
| SMILES | COc1cccc(CN2CCC(N3C(=O)NC4CCCC[C@@H]4[C@H]3c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H35N3O2/c1-32-23-11-7-8-20(18-23)19-29-16-14-22(15-17-29)30-26(21-9-3-2-4-10-21)24-12-5-6-13-25(24)28-27(30)31/h2-4,7-11,18,22,24-26H,5-6,12-17,19H2,1H3,(H,28,31)/t24-,25?,26+/m0/s1 |
| InChIKey | YVNOCRRMVKDCHJ-KCIKGWAESA-N |
| XLogP | 4.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |