C22H30N2O — CID 22867494
(1S)-1-[(2S,3R)-3-[(1S)-1-amino-4-phenylbutyl]oxiran-2-yl]-4-phenylbutan-1-amine (PubChem CID 22867494) has the molecular formula C22H30N2O and a molecular weight of 338.49 g/mol. Its IUPAC name is (1S)-1-[(2S,3R)-3-[(1S)-1-amino-4-phenylbutyl]oxiran-2-yl]-4-phenylbutan-1-amine.
| Compound Name | (1S)-1-[(2S,3R)-3-[(1S)-1-amino-4-phenylbutyl]oxiran-2-yl]-4-phenylbutan-1-amine |
|---|---|
| PubChem CID | 22867494 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (1S)-1-[(2S,3R)-3-[(1S)-1-amino-4-phenylbutyl]oxiran-2-yl]-4-phenylbutan-1-amine |
| SMILES | N[C@@H](CCCc1ccccc1)[C@@H]1O[C@@H]1[C@@H](N)CCCc1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c23-19(15-7-13-17-9-3-1-4-10-17)21-22(25-21)20(24)16-8-14-18-11-5-2-6-12-18/h1-6,9-12,19-22H,7-8,13-16,23-24H2/t19-,20-,21-,22+/m0/s1 |
| InChIKey | MIXUMMZYNMWCME-MYGLTJDJSA-N |
| XLogP | 3.45 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|