C19H22FNO3 — CID 22874192
(2R,4S,5S)-5-amino-2-benzyl-6-(4-fluorophenyl)-4-hydroxyhexanoic acid (PubChem CID 22874192) has the molecular formula C19H22FNO3 and a molecular weight of 331.39 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-2-benzyl-6-(4-fluorophenyl)-4-hydroxyhexanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-2-benzyl-6-(4-fluorophenyl)-4-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 22874192 |
| Molecular Formula | C19H22FNO3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2R,4S,5S)-5-amino-2-benzyl-6-(4-fluorophenyl)-4-hydroxyhexanoic acid |
| SMILES | N[C@@H](Cc1ccc(F)cc1)[C@@H](O)C[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H22FNO3/c20-16-8-6-14(7-9-16)11-17(21)18(22)12-15(19(23)24)10-13-4-2-1-3-5-13/h1-9,15,17-18,22H,10-12,21H2,(H,23,24)/t15-,17+,18+/m1/s1 |
| InChIKey | WDQKOEBPSIAVHT-NJAFHUGGSA-N |
| XLogP | 2.39 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |