C19H24N2O3 — CID 69257317
[(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl] carbamate (PubChem CID 69257317) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl] carbamate.
| Compound Name | [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl] carbamate |
|---|---|
| PubChem CID | 69257317 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | [(2S,4S,5S)-5-amino-4-hydroxy-1,6-diphenylhexan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H](Cc1ccccc1)C[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O3/c20-17(12-15-9-5-2-6-10-15)18(22)13-16(24-19(21)23)11-14-7-3-1-4-8-14/h1-10,16-18,22H,11-13,20H2,(H2,21,23)/t16-,17-,18-/m0/s1 |
| InChIKey | WKQUVSADDLUYGE-BZSNNMDCSA-N |
| XLogP | 2.01 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |