C18H19NO2 — CID 175314051
1,5-diphenylpent-4-en-2-yl carbamate (PubChem CID 175314051) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1,5-diphenylpent-4-en-2-yl carbamate.
| Compound Name | 1,5-diphenylpent-4-en-2-yl carbamate |
|---|---|
| PubChem CID | 175314051 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1,5-diphenylpent-4-en-2-yl carbamate |
| SMILES | NC(=O)OC(CC=Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c19-18(20)21-17(14-16-10-5-2-6-11-16)13-7-12-15-8-3-1-4-9-15/h1-12,17H,13-14H2,(H2,19,20) |
| InChIKey | VUAWKCDYAGZATF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |