C23H41N3O7Si2 — CID 22875272
1-[(6aS,8R,9R,9aS)-6-acetyl-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one (PubChem CID 22875272) has the molecular formula C23H41N3O7Si2 and a molecular weight of 527.77 g/mol. Its IUPAC name is 1-[(6aS,8R,9R,9aS)-6-acetyl-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(6aS,8R,9R,9aS)-6-acetyl-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 22875272 |
| Molecular Formula | C23H41N3O7Si2 |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 1-[(6aS,8R,9R,9aS)-6-acetyl-9-hydroxy-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
| SMILES | CC(=O)C1O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@@H](O)[C@H](n3ccc(N)nc3=O)O[C@H]12 |
| InChI | InChI=1S/C23H41N3O7Si2/c1-12(2)34(13(3)4)31-19(16(9)27)21-20(32-35(33-34,14(5)6)15(7)8)18(28)22(30-21)26-11-10-17(24)25-23(26)29/h10-15,18-22,28H,1-9H3,(H2,24,25,29)/t18-,19?,20+,21-,22-/m1/s1 |
| InChIKey | XQRUCRDRNAYPIV-JMSZQJPUSA-N |
| XLogP | 3.00 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|