C30H47N3O7SSi2 — CID 69411631
1-[(6aS,8R,9R,9aR)-6-benzoyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one (PubChem CID 69411631) has the molecular formula C30H47N3O7SSi2 and a molecular weight of 649.96 g/mol. Its IUPAC name is 1-[(6aS,8R,9R,9aR)-6-benzoyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(6aS,8R,9R,9aR)-6-benzoyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 69411631 |
| Molecular Formula | C30H47N3O7SSi2 |
| Molecular Weight | 649.96 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 1-[(6aS,8R,9R,9aR)-6-benzoyl-9-(methylsulfanylmethoxy)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-4-aminopyrimidin-2-one |
| SMILES | CSCO[C@@H]1[C@@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OC(C(=O)c3ccccc3)[C@H]2O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C30H47N3O7SSi2/c1-18(2)42(19(3)4)38-25(24(34)22-13-11-10-12-14-22)26-27(39-43(40-42,20(5)6)21(7)8)28(36-17-41-9)29(37-26)33-16-15-23(31)32-30(33)35/h10-16,18-21,25-29H,17H2,1-9H3,(H2,31,32,35)/t25?,26-,27-,28-,29-/m1/s1 |
| InChIKey | RALQSMOKKITAGC-SCNPRXQJSA-N |
| XLogP | 5.64 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|