C22H34N2O5S — CID 22882269
(2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-(methoxymethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid (PubChem CID 22882269) has the molecular formula C22H34N2O5S and a molecular weight of 438.59 g/mol. Its IUPAC name is (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-(methoxymethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid.
| Compound Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-(methoxymethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid |
|---|---|
| PubChem CID | 22882269 |
| Molecular Formula | C22H34N2O5S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | (2R,4S,5S)-5-amino-4-hydroxy-9-[(2R)-2-(methoxymethyl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2,7,7-trimethyl-9-oxononanoic acid |
| SMILES | COC[C@H]1CN(C(=O)CC(C)(C)C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)O)c2ccccc2S1 |
| InChI | InChI=1S/C22H34N2O5S/c1-14(21(27)28)9-18(25)16(23)10-22(2,3)11-20(26)24-12-15(13-29-4)30-19-8-6-5-7-17(19)24/h5-8,14-16,18,25H,9-13,23H2,1-4H3,(H,27,28)/t14-,15-,16+,18+/m1/s1 |
| InChIKey | NZOJXWXJMQPVAD-CBZIJGRNSA-N |
| XLogP | 2.75 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |