C27H39N — CID 22882802
2-[(8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]-N,N-dimethylaniline (PubChem CID 22882802) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]-N,N-dimethylaniline.
| Compound Name | 2-[(8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 22882802 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 2-[(8S,9S,10R,13S,14S)-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1C1=C2CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@@]2(C)CCC1 |
| InChI | InChI=1S/C27H39N/c1-26-16-8-11-22(26)21-13-14-23-19(20-9-5-6-12-25(20)28(3)4)10-7-17-27(23,2)24(21)15-18-26/h5-6,9,12,21-22,24H,7-8,10-11,13-18H2,1-4H3/t21-,22-,24-,26-,27-/m0/s1 |
| InChIKey | JLDKYMALWNKUFB-KVVMQPAJSA-N |
| XLogP | 7.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |