C24H33N5O4S2 — CID 22887602
N-[4-(2-acetylhydrazinyl)phenyl]-3-[3-(2-piperidin-1-ylethylsulfanyl)prop-1-en-2-yloxyamino]benzenesulfonamide (PubChem CID 22887602) has the molecular formula C24H33N5O4S2 and a molecular weight of 519.69 g/mol. Its IUPAC name is N-[4-(2-acetylhydrazinyl)phenyl]-3-[3-(2-piperidin-1-ylethylsulfanyl)prop-1-en-2-yloxyamino]benzenesulfonamide.
| Compound Name | N-[4-(2-acetylhydrazinyl)phenyl]-3-[3-(2-piperidin-1-ylethylsulfanyl)prop-1-en-2-yloxyamino]benzenesulfonamide |
|---|---|
| PubChem CID | 22887602 |
| Molecular Formula | C24H33N5O4S2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | N-[4-(2-acetylhydrazinyl)phenyl]-3-[3-(2-piperidin-1-ylethylsulfanyl)prop-1-en-2-yloxyamino]benzenesulfonamide |
| SMILES | C=C(CSCCN1CCCCC1)ONc1cccc(S(=O)(=O)Nc2ccc(NNC(C)=O)cc2)c1 |
| InChI | InChI=1S/C24H33N5O4S2/c1-19(18-34-16-15-29-13-4-3-5-14-29)33-27-23-7-6-8-24(17-23)35(31,32)28-22-11-9-21(10-12-22)26-25-20(2)30/h6-12,17,26-28H,1,3-5,13-16,18H2,2H3,(H,25,30) |
| InChIKey | KKFXGMIJAAFOGI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|