C27H38N6O7S3 — CID 20725368
2-[2-[4-[[3-[[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]acetyl]amino]phenyl]sulfonylamino]phenyl]hydrazinyl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide (PubChem CID 20725368) has the molecular formula C27H38N6O7S3 and a molecular weight of 654.84 g/mol. Its IUPAC name is 2-[2-[4-[[3-[[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]acetyl]amino]phenyl]sulfonylamino]phenyl]hydrazinyl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide.
| Compound Name | 2-[2-[4-[[3-[[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]acetyl]amino]phenyl]sulfonylamino]phenyl]hydrazinyl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 20725368 |
| Molecular Formula | C27H38N6O7S3 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.20 |
| IUPAC Name | 2-[2-[4-[[3-[[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]acetyl]amino]phenyl]sulfonylamino]phenyl]hydrazinyl]-N-(3-morpholin-4-ylpropyl)-2-oxoacetamide |
| SMILES | O=C(CSCCSCCO)Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)C(=O)NCCCN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C27H38N6O7S3/c34-13-16-41-17-18-42-20-25(35)29-23-3-1-4-24(19-23)43(38,39)32-22-7-5-21(6-8-22)30-31-27(37)26(36)28-9-2-10-33-11-14-40-15-12-33/h1,3-8,19,30,32,34H,2,9-18,20H2,(H,28,36)(H,29,35)(H,31,37) |
| InChIKey | LVSNDJJAWDJKNA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 178.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|