C43H49N8O9S3+ — CID 22889734
benzyl-dibutyl-[2-oxo-2-[3-[[4-[[4-[2-(5-sulfoindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]anilino]ethyl]azanium (PubChem CID 22889734) has the molecular formula C43H49N8O9S3+ and a molecular weight of 918.11 g/mol. Its IUPAC name is benzyl-dibutyl-[2-oxo-2-[3-[[4-[[4-[2-(5-sulfoindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]anilino]ethyl]azanium.
| Compound Name | benzyl-dibutyl-[2-oxo-2-[3-[[4-[[4-[2-(5-sulfoindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]anilino]ethyl]azanium |
|---|---|
| PubChem CID | 22889734 |
| Molecular Formula | C43H49N8O9S3+ |
| Molecular Weight | 918.11 g/mol |
| Exact Mass | 917.28 |
| IUPAC Name | benzyl-dibutyl-[2-oxo-2-[3-[[4-[[4-[2-(5-sulfoindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]anilino]ethyl]azanium |
| SMILES | CCCC[N+](CCCC)(CC(=O)Nc1cccc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3ccc(NNC(=O)n4ncc5cc(S(=O)(=O)O)ccc54)cc3)cc2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C43H48N8O9S3/c1-3-5-25-51(26-6-4-2,30-32-11-8-7-9-12-32)31-42(52)45-37-13-10-14-39(28-37)62(56,57)49-36-19-21-38(22-20-36)61(54,55)48-35-17-15-34(16-18-35)46-47-43(53)50-41-24-23-40(63(58,59)60)27-33(41)29-44-50/h7-24,27-29,46,48-49H,3-6,25-26,30-31H2,1-2H3,(H2-,45,47,52,53,58,59,60)/p+1 |
| InChIKey | TWYGIKLTLUAAPQ-UHFFFAOYSA-O |
| XLogP | 7.03 |
| TPSA | 234.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.11 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|