C33H35N9O7S3 — CID 22889752
1-hexyl-3-[4-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]thiourea (PubChem CID 22889752) has the molecular formula C33H35N9O7S3 and a molecular weight of 765.90 g/mol. Its IUPAC name is 1-hexyl-3-[4-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]thiourea.
| Compound Name | 1-hexyl-3-[4-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 22889752 |
| Molecular Formula | C33H35N9O7S3 |
| Molecular Weight | 765.90 g/mol |
| Exact Mass | 765.18 |
| IUPAC Name | 1-hexyl-3-[4-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]thiourea |
| SMILES | CCCCCCNC(=S)Nc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NNC(=O)n4ncc5c([N+](=O)[O-])cccc54)cc3)c2)cc1 |
| InChI | InChI=1S/C33H35N9O7S3/c1-2-3-4-5-20-34-32(50)36-23-16-18-27(19-17-23)51(46,47)40-26-8-6-9-28(21-26)52(48,49)39-25-14-12-24(13-15-25)37-38-33(43)41-30-10-7-11-31(42(44)45)29(30)22-35-41/h6-19,21-22,37,39-40H,2-5,20H2,1H3,(H,38,43)(H2,34,36,50) |
| InChIKey | JLINDUHWUZDRLA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.90 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|