C29H24N12O6S — CID 22889740
1-[4-[2-[4-(hydroperoxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]-3-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]thiourea (PubChem CID 22889740) has the molecular formula C29H24N12O6S and a molecular weight of 668.66 g/mol. Its IUPAC name is 1-[4-[2-[4-(hydroperoxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]-3-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]thiourea.
| Compound Name | 1-[4-[2-[4-(hydroperoxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]-3-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]thiourea |
|---|---|
| PubChem CID | 22889740 |
| Molecular Formula | C29H24N12O6S |
| Molecular Weight | 668.66 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | 1-[4-[2-[4-(hydroperoxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]-3-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]thiourea |
| SMILES | O=C(NNc1ccc(NC(=S)Nc2ccc(NNC(=O)n3ncc4c([N+](=O)[O-])cccc43)cc2)cc1)n1ncc2c(NOO)cccc21 |
| InChI | InChI=1S/C29H24N12O6S/c42-28(39-24-4-1-3-23(38-47-46)21(24)15-30-39)36-34-19-11-7-17(8-12-19)32-27(48)33-18-9-13-20(14-10-18)35-37-29(43)40-25-5-2-6-26(41(44)45)22(25)16-31-40/h1-16,34-35,38,46H,(H,36,42)(H,37,43)(H2,32,33,48) |
| InChIKey | HOCZTRLUSJFAOH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 226.59 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|