About 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide
2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide (PubChem CID 54449111) has the molecular formula C28H24N5O3+
and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide.
Molecular Properties
| Compound Name | 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide |
| PubChem CID | 54449111 |
| Molecular Formula | C28H24N5O3+ |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide |
| SMILES | C[n+]1cc2c([N+](=O)[O-])cccc2n1C(=O)NNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N5O3/c1-31-20-24-25(18-11-19-26(24)33(35)36)32(31)27(34)29-30-28(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-20,30H,1H3/p+1 |
| InChIKey | NTCYJJBBMHTGFH-UHFFFAOYSA-O |
| XLogP | 4.43 |
| TPSA | 93.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide?
The IUPAC name of 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide (CID 54449111) is 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide.
What is the SMILES notation for 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide?
The canonical SMILES for 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide is C[n+]1cc2c([N+](=O)[O-])cccc2n1C(=O)NNC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide?
The InChIKey is NTCYJJBBMHTGFH-UHFFFAOYSA-O. The full InChI is InChI=1S/C28H23N5O3/c1-31-20-24-25(18-11-19-26(24)33(35)36)32(31)27(34)29-30-28(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-20,30H,1H3/p+1.
What are the key properties of 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide?
2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide has a molecular weight of 478.53 g/mol, XLogP of 4.43, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-nitro-N'-tritylindazol-2-ium-1-carbohydrazide is sourced from PubChem (CID 54449111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).