C33H26N12O8S2 — CID 22889829
1-(2H-benzotriazol-5-yl)-3-[3-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]urea (PubChem CID 22889829) has the molecular formula C33H26N12O8S2 and a molecular weight of 782.78 g/mol. Its IUPAC name is 1-(2H-benzotriazol-5-yl)-3-[3-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]urea.
| Compound Name | 1-(2H-benzotriazol-5-yl)-3-[3-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 22889829 |
| Molecular Formula | C33H26N12O8S2 |
| Molecular Weight | 782.78 g/mol |
| Exact Mass | 782.14 |
| IUPAC Name | 1-(2H-benzotriazol-5-yl)-3-[3-[[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]sulfamoyl]phenyl]urea |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NNC(=O)n4ncc5c([N+](=O)[O-])cccc54)cc3)c2)c1)Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C33H26N12O8S2/c46-32(36-23-14-15-28-29(18-23)39-43-38-28)35-22-4-1-6-25(16-22)55(52,53)42-24-5-2-7-26(17-24)54(50,51)41-21-12-10-20(11-13-21)37-40-33(47)44-30-8-3-9-31(45(48)49)27(30)19-34-44/h1-19,37,41-42H,(H,40,47)(H2,35,36,46)(H,38,39,43) |
| InChIKey | KKCZQNXXNMOFFD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 277.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.78 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|