C28H24N6O8S2 — CID 23565965
2-[4-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]phenyl]ethanesulfonic acid (PubChem CID 23565965) has the molecular formula C28H24N6O8S2 and a molecular weight of 636.67 g/mol. Its IUPAC name is 2-[4-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]phenyl]ethanesulfonic acid.
| Compound Name | 2-[4-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 23565965 |
| Molecular Formula | C28H24N6O8S2 |
| Molecular Weight | 636.67 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | 2-[4-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]phenyl]ethanesulfonic acid |
| SMILES | O=C(NNc1ccc(NS(=O)(=O)c2cccc(-c3ccc(CCS(=O)(=O)O)cc3)c2)cc1)n1ncc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C28H24N6O8S2/c35-28(33-26-5-2-6-27(34(36)37)25(26)18-29-33)31-30-22-11-13-23(14-12-22)32-44(41,42)24-4-1-3-21(17-24)20-9-7-19(8-10-20)15-16-43(38,39)40/h1-14,17-18,30,32H,15-16H2,(H,31,35)(H,38,39,40) |
| InChIKey | QTPGQCIAYRUUQK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 202.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.67 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|