C34H28ClN7O6S2 — CID 20603749
3-[[[(4-chlorophenyl)-phenylmethyl]-methylidene-oxo-λ6-sulfanyl]amino]-N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide (PubChem CID 20603749) has the molecular formula C34H28ClN7O6S2 and a molecular weight of 730.23 g/mol. Its IUPAC name is 3-[[[(4-chlorophenyl)-phenylmethyl]-methylidene-oxo-λ6-sulfanyl]amino]-N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide.
| Compound Name | 3-[[[(4-chlorophenyl)-phenylmethyl]-methylidene-oxo-λ6-sulfanyl]amino]-N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20603749 |
| Molecular Formula | C34H28ClN7O6S2 |
| Molecular Weight | 730.23 g/mol |
| Exact Mass | 729.12 |
| IUPAC Name | 3-[[[(4-chlorophenyl)-phenylmethyl]-methylidene-oxo-λ6-sulfanyl]amino]-N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide |
| SMILES | C=S(=O)(Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)n3ncc4c([N+](=O)[O-])cccc43)cc2)c1)C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H28ClN7O6S2/c1-49(46,33(23-7-3-2-4-8-23)24-13-15-25(35)16-14-24)39-28-9-5-10-29(21-28)50(47,48)40-27-19-17-26(18-20-27)37-38-34(43)41-31-11-6-12-32(42(44)45)30(31)22-36-41/h2-22,33,37,40H,1H2,(H,38,43)(H,39,46) |
| InChIKey | RBXUTQHKQXDYRB-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.23 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|