C23H20ClN7O6S2 — CID 23387050
N-[3-[[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-methylsulfanylacetamide (PubChem CID 23387050) has the molecular formula C23H20ClN7O6S2 and a molecular weight of 590.04 g/mol. Its IUPAC name is N-[3-[[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-methylsulfanylacetamide.
| Compound Name | N-[3-[[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 23387050 |
| Molecular Formula | C23H20ClN7O6S2 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | N-[3-[[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-methylsulfanylacetamide |
| SMILES | CSCC(=O)Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)n3ncc4c([N+](=O)[O-])cc(Cl)cc43)cc2)c1 |
| InChI | InChI=1S/C23H20ClN7O6S2/c1-38-13-22(32)26-17-3-2-4-18(11-17)39(36,37)29-16-7-5-15(6-8-16)27-28-23(33)30-20-9-14(24)10-21(31(34)35)19(20)12-25-30/h2-12,27,29H,13H2,1H3,(H,26,32)(H,28,33) |
| InChIKey | QKUBLWJBMSPLHU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 177.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|