C28H31N7O7S2 — CID 22889771
2-(2-butoxyethylsulfanyl)-N-[3-[[4-[2-(5-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 22889771) has the molecular formula C28H31N7O7S2 and a molecular weight of 641.73 g/mol. Its IUPAC name is 2-(2-butoxyethylsulfanyl)-N-[3-[[4-[2-(5-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(2-butoxyethylsulfanyl)-N-[3-[[4-[2-(5-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22889771 |
| Molecular Formula | C28H31N7O7S2 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.17 |
| IUPAC Name | 2-(2-butoxyethylsulfanyl)-N-[3-[[4-[2-(5-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CCCCOCCSCC(=O)Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)n3ncc4cc([N+](=O)[O-])ccc43)cc2)c1 |
| InChI | InChI=1S/C28H31N7O7S2/c1-2-3-13-42-14-15-43-19-27(36)30-23-5-4-6-25(17-23)44(40,41)33-22-9-7-21(8-10-22)31-32-28(37)34-26-12-11-24(35(38)39)16-20(26)18-29-34/h4-12,16-18,31,33H,2-3,13-15,19H2,1H3,(H,30,36)(H,32,37) |
| InChIKey | NMBVUWODJULKKV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|