C29H27N7O9S2 — CID 59912482
3-methyl-N-[3-[[4-[2-[6-(methylperoxymethyl)-4-nitroindazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]benzenesulfonamide (PubChem CID 59912482) has the molecular formula C29H27N7O9S2 and a molecular weight of 681.71 g/mol. Its IUPAC name is 3-methyl-N-[3-[[4-[2-[6-(methylperoxymethyl)-4-nitroindazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[3-[[4-[2-[6-(methylperoxymethyl)-4-nitroindazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59912482 |
| Molecular Formula | C29H27N7O9S2 |
| Molecular Weight | 681.71 g/mol |
| Exact Mass | 681.13 |
| IUPAC Name | 3-methyl-N-[3-[[4-[2-[6-(methylperoxymethyl)-4-nitroindazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]benzenesulfonamide |
| SMILES | COOCc1cc([N+](=O)[O-])c2cnn(C(=O)NNc3ccc(NS(=O)(=O)c4cccc(NS(=O)(=O)c5cccc(C)c5)c4)cc3)c2c1 |
| InChI | InChI=1S/C29H27N7O9S2/c1-19-5-3-7-24(13-19)46(40,41)34-23-6-4-8-25(16-23)47(42,43)33-22-11-9-21(10-12-22)31-32-29(37)35-27-14-20(18-45-44-2)15-28(36(38)39)26(27)17-30-35/h3-17,31,33-34H,18H2,1-2H3,(H,32,37) |
| InChIKey | LKULCOPHQJSYCR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 212.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|