C39H47N7O11S2 — CID 59915784
methyl 1-[6-[[3-[(3-decoxycarbonylphenyl)sulfonylamino]phenyl]sulfonylamino]-1,2-diazaspiro[2.5]octane-2-carbonyl]-4-nitroindazole-6-carboxylate (PubChem CID 59915784) has the molecular formula C39H47N7O11S2 and a molecular weight of 853.98 g/mol. Its IUPAC name is methyl 1-[6-[[3-[(3-decoxycarbonylphenyl)sulfonylamino]phenyl]sulfonylamino]-1,2-diazaspiro[2.5]octane-2-carbonyl]-4-nitroindazole-6-carboxylate.
| Compound Name | methyl 1-[6-[[3-[(3-decoxycarbonylphenyl)sulfonylamino]phenyl]sulfonylamino]-1,2-diazaspiro[2.5]octane-2-carbonyl]-4-nitroindazole-6-carboxylate |
|---|---|
| PubChem CID | 59915784 |
| Molecular Formula | C39H47N7O11S2 |
| Molecular Weight | 853.98 g/mol |
| Exact Mass | 853.28 |
| IUPAC Name | methyl 1-[6-[[3-[(3-decoxycarbonylphenyl)sulfonylamino]phenyl]sulfonylamino]-1,2-diazaspiro[2.5]octane-2-carbonyl]-4-nitroindazole-6-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)NC3CCC4(CC3)NN4C(=O)n3ncc4c([N+](=O)[O-])cc(C(=O)OC)cc43)c2)c1 |
| InChI | InChI=1S/C39H47N7O11S2/c1-3-4-5-6-7-8-9-10-21-57-37(48)27-13-11-15-31(22-27)58(52,53)42-30-14-12-16-32(25-30)59(54,55)41-29-17-19-39(20-18-29)43-45(39)38(49)44-34-23-28(36(47)56-2)24-35(46(50)51)33(34)26-40-44/h11-16,22-26,29,41-43H,3-10,17-21H2,1-2H3 |
| InChIKey | LYIVBOFXTRMTMB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 247.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.98 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|