C29H25N7O9S2 — CID 23566007
methyl 1-[[4-[[3-[(3-methylphenyl)sulfonylamino]phenyl]sulfonylamino]anilino]carbamoyl]-4-nitroindazole-6-carboxylate (PubChem CID 23566007) has the molecular formula C29H25N7O9S2 and a molecular weight of 679.69 g/mol. Its IUPAC name is methyl 1-[[4-[[3-[(3-methylphenyl)sulfonylamino]phenyl]sulfonylamino]anilino]carbamoyl]-4-nitroindazole-6-carboxylate.
| Compound Name | methyl 1-[[4-[[3-[(3-methylphenyl)sulfonylamino]phenyl]sulfonylamino]anilino]carbamoyl]-4-nitroindazole-6-carboxylate |
|---|---|
| PubChem CID | 23566007 |
| Molecular Formula | C29H25N7O9S2 |
| Molecular Weight | 679.69 g/mol |
| Exact Mass | 679.12 |
| IUPAC Name | methyl 1-[[4-[[3-[(3-methylphenyl)sulfonylamino]phenyl]sulfonylamino]anilino]carbamoyl]-4-nitroindazole-6-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c2cnn(C(=O)NNc3ccc(NS(=O)(=O)c4cccc(NS(=O)(=O)c5cccc(C)c5)c4)cc3)c2c1 |
| InChI | InChI=1S/C29H25N7O9S2/c1-18-5-3-7-23(13-18)46(41,42)34-22-6-4-8-24(16-22)47(43,44)33-21-11-9-20(10-12-21)31-32-29(38)35-26-14-19(28(37)45-2)15-27(36(39)40)25(26)17-30-35/h3-17,31,33-34H,1-2H3,(H,32,38) |
| InChIKey | FRIPOHQMQSBUDV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 220.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|