C30H29N7O9S — CID 91473921
3-amino-N-[4-(2-methylhydrazinyl)oxyphenyl]benzenesulfonamide;6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate (PubChem CID 91473921) has the molecular formula C30H29N7O9S and a molecular weight of 663.67 g/mol. Its IUPAC name is 3-amino-N-[4-(2-methylhydrazinyl)oxyphenyl]benzenesulfonamide;6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate.
| Compound Name | 3-amino-N-[4-(2-methylhydrazinyl)oxyphenyl]benzenesulfonamide;6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate |
|---|---|
| PubChem CID | 91473921 |
| Molecular Formula | C30H29N7O9S |
| Molecular Weight | 663.67 g/mol |
| Exact Mass | 663.17 |
| IUPAC Name | 3-amino-N-[4-(2-methylhydrazinyl)oxyphenyl]benzenesulfonamide;6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate |
| SMILES | CNNOc1ccc(NS(=O)(=O)c2cccc(N)c2)cc1.COC(=O)c1cc(C)c2cnn(C(=O)Oc3ccc([N+](=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C17H13N3O6.C13H16N4O3S/c1-10-7-11(16(21)25-2)8-15-14(10)9-18-19(15)17(22)26-13-5-3-12(4-6-13)20(23)24;1-15-17-20-12-7-5-11(6-8-12)16-21(18,19)13-4-2-3-10(14)9-13/h3-9H,1-2H3;2-9,15-17H,14H2,1H3 |
| InChIKey | ODZDFGGZHPRGES-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 219.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.67 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|