C34H37N7O7S2 — CID 22889967
N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-octylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 22889967) has the molecular formula C34H37N7O7S2 and a molecular weight of 719.85 g/mol. Its IUPAC name is N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-octylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-octylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 22889967 |
| Molecular Formula | C34H37N7O7S2 |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.22 |
| IUPAC Name | N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-octylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCCCCCCc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NNC(=O)n4ncc5c([N+](=O)[O-])cccc54)cc3)c2)cc1 |
| InChI | InChI=1S/C34H37N7O7S2/c1-2-3-4-5-6-7-10-25-15-21-29(22-16-25)49(45,46)39-28-11-8-12-30(23-28)50(47,48)38-27-19-17-26(18-20-27)36-37-34(42)40-32-13-9-14-33(41(43)44)31(32)24-35-40/h8-9,11-24,36,38-39H,2-7,10H2,1H3,(H,37,42) |
| InChIKey | TVYYELZEFAAFRJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 194.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|