C27H22N8O9S2 — CID 22889964
N-[4-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 22889964) has the molecular formula C27H22N8O9S2 and a molecular weight of 666.65 g/mol. Its IUPAC name is N-[4-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | N-[4-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 22889964 |
| Molecular Formula | C27H22N8O9S2 |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.10 |
| IUPAC Name | N-[4-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]-3-[(4-methylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NNC(=O)n4nc([N+](=O)[O-])c5cc([N+](=O)[O-])ccc54)cc3)c2)cc1 |
| InChI | InChI=1S/C27H22N8O9S2/c1-17-5-12-22(13-6-17)45(41,42)32-20-3-2-4-23(15-20)46(43,44)31-19-9-7-18(8-10-19)28-29-27(36)33-25-14-11-21(34(37)38)16-24(25)26(30-33)35(39)40/h2-16,28,31-32H,1H3,(H,29,36) |
| InChIKey | TXPHBWQXGDMTPG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 237.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|