C21H20N8O7S2 — CID 90803154
N-[3-[[3-[2-[3,5-bis(dihydroxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide (PubChem CID 90803154) has the molecular formula C21H20N8O7S2 and a molecular weight of 560.57 g/mol. Its IUPAC name is N-[3-[[3-[2-[3,5-bis(dihydroxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide.
| Compound Name | N-[3-[[3-[2-[3,5-bis(dihydroxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide |
|---|---|
| PubChem CID | 90803154 |
| Molecular Formula | C21H20N8O7S2 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | N-[3-[[3-[2-[3,5-bis(dihydroxyamino)indazole-1-carbonyl]hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide |
| SMILES | O=C(NNc1cccc(NS(=O)(=O)c2cccc(NC=S)c2)c1)n1nc(N(O)O)c2cc(N(O)O)ccc21 |
| InChI | InChI=1S/C21H20N8O7S2/c30-21(27-19-8-7-16(28(31)32)11-18(19)20(25-27)29(33)34)24-23-14-4-1-5-15(9-14)26-38(35,36)17-6-2-3-13(10-17)22-12-37/h1-12,23,26,31-34H,(H,22,37)(H,24,30) |
| InChIKey | ISGIDFASAMGPFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 204.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|