C21H16N8O7S2 — CID 23387048
N-[3-[[3-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide (PubChem CID 23387048) has the molecular formula C21H16N8O7S2 and a molecular weight of 556.54 g/mol. Its IUPAC name is N-[3-[[3-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide.
| Compound Name | N-[3-[[3-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide |
|---|---|
| PubChem CID | 23387048 |
| Molecular Formula | C21H16N8O7S2 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | N-[3-[[3-[2-(3,5-dinitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]methanethioamide |
| SMILES | O=C(NNc1cccc(NS(=O)(=O)c2cccc(NC=S)c2)c1)n1nc([N+](=O)[O-])c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H16N8O7S2/c30-21(27-19-8-7-16(28(31)32)11-18(19)20(25-27)29(33)34)24-23-14-4-1-5-15(9-14)26-38(35,36)17-6-2-3-13(10-17)22-12-37/h1-12,23,26H,(H,22,37)(H,24,30) |
| InChIKey | TZLHQEOAALCTEQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 203.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|