C20H18N6O3S — CID 21131462
N-[4-[2-(4-aminoindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide (PubChem CID 21131462) has the molecular formula C20H18N6O3S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-[4-[2-(4-aminoindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[2-(4-aminoindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 21131462 |
| Molecular Formula | C20H18N6O3S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[4-[2-(4-aminoindazole-1-carbonyl)hydrazinyl]phenyl]benzenesulfonamide |
| SMILES | Nc1cccc2c1cnn2C(=O)NNc1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N6O3S/c21-18-7-4-8-19-17(18)13-22-26(19)20(27)24-23-14-9-11-15(12-10-14)25-30(28,29)16-5-2-1-3-6-16/h1-13,23,25H,21H2,(H,24,27) |
| InChIKey | LSSBOCVWWHZSCQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|