C28H22N8O7S2 — CID 23566023
N-[3-[[4-[2-(5-cyano-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-3-methylbenzenesulfonamide (PubChem CID 23566023) has the molecular formula C28H22N8O7S2 and a molecular weight of 646.67 g/mol. Its IUPAC name is N-[3-[[4-[2-(5-cyano-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[3-[[4-[2-(5-cyano-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23566023 |
| Molecular Formula | C28H22N8O7S2 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.11 |
| IUPAC Name | N-[3-[[4-[2-(5-cyano-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NNC(=O)n4ncc5cc(C#N)c([N+](=O)[O-])cc54)cc3)c2)c1 |
| InChI | InChI=1S/C28H22N8O7S2/c1-18-4-2-6-24(12-18)44(40,41)34-23-5-3-7-25(14-23)45(42,43)33-22-10-8-21(9-11-22)31-32-28(37)35-26-15-27(36(38)39)19(16-29)13-20(26)17-30-35/h2-15,17,31,33-34H,1H3,(H,32,37) |
| InChIKey | AQVKOCZAXIHCRB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 218.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|