C29H32N8O9S2 — CID 59916328
N-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-[4-[2-(trioxidanylsulfanyl)ethyl]piperidin-1-yl]acetamide (PubChem CID 59916328) has the molecular formula C29H32N8O9S2 and a molecular weight of 700.76 g/mol. Its IUPAC name is N-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-[4-[2-(trioxidanylsulfanyl)ethyl]piperidin-1-yl]acetamide.
| Compound Name | N-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-[4-[2-(trioxidanylsulfanyl)ethyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 59916328 |
| Molecular Formula | C29H32N8O9S2 |
| Molecular Weight | 700.76 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | N-[3-[[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]sulfamoyl]phenyl]-2-[4-[2-(trioxidanylsulfanyl)ethyl]piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(CCSOOO)CC1)Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)n3ncc4c([N+](=O)[O-])cccc43)cc2)c1 |
| InChI | InChI=1S/C29H32N8O9S2/c38-28(19-35-14-11-20(12-15-35)13-16-47-46-45-42)31-23-3-1-4-24(17-23)48(43,44)34-22-9-7-21(8-10-22)32-33-29(39)36-26-5-2-6-27(37(40)41)25(26)18-30-36/h1-10,17-18,20,32,34,42H,11-16,19H2,(H,31,38)(H,33,39) |
| InChIKey | MARUMINNAQVHRI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 219.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|