C22H16N10O6 — CID 22889882
4-nitro-N'-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]indazole-1-carbohydrazide (PubChem CID 22889882) has the molecular formula C22H16N10O6 and a molecular weight of 516.43 g/mol. Its IUPAC name is 4-nitro-N'-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]indazole-1-carbohydrazide.
| Compound Name | 4-nitro-N'-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]indazole-1-carbohydrazide |
|---|---|
| PubChem CID | 22889882 |
| Molecular Formula | C22H16N10O6 |
| Molecular Weight | 516.43 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 4-nitro-N'-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]indazole-1-carbohydrazide |
| SMILES | O=C(NNc1ccc(NNC(=O)n2ncc3c([N+](=O)[O-])cccc32)cc1)n1ncc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C22H16N10O6/c33-21(29-17-3-1-5-19(31(35)36)15(17)11-23-29)27-25-13-7-9-14(10-8-13)26-28-22(34)30-18-4-2-6-20(32(37)38)16(18)12-24-30/h1-12,25-26H,(H,27,33)(H,28,34) |
| InChIKey | PIZFKJZFKGPFFD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 204.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|