C14H25N2+ — CID 22889878
[4-[[ethyl(methyl)amino]methyl]phenyl]methyl-trimethylazanium (PubChem CID 22889878) has the molecular formula C14H25N2+ and a molecular weight of 221.37 g/mol. Its IUPAC name is [4-[[ethyl(methyl)amino]methyl]phenyl]methyl-trimethylazanium.
| Compound Name | [4-[[ethyl(methyl)amino]methyl]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 22889878 |
| Molecular Formula | C14H25N2+ |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.20 |
| IUPAC Name | [4-[[ethyl(methyl)amino]methyl]phenyl]methyl-trimethylazanium |
| SMILES | CCN(C)Cc1ccc(C[N+](C)(C)C)cc1 |
| InChI | InChI=1S/C14H25N2/c1-6-15(2)11-13-7-9-14(10-8-13)12-16(3,4)5/h7-10H,6,11-12H2,1-5H3/q+1 |
| InChIKey | JENOSBVTBXQDEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|