C11H18NO2P — CID 143297095
[4-[[ethyl(methyl)amino]methyl]phenyl]-methylphosphinic acid (PubChem CID 143297095) has the molecular formula C11H18NO2P and a molecular weight of 227.24 g/mol. Its IUPAC name is [4-[[ethyl(methyl)amino]methyl]phenyl]-methylphosphinic acid.
| Compound Name | [4-[[ethyl(methyl)amino]methyl]phenyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 143297095 |
| Molecular Formula | C11H18NO2P |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [4-[[ethyl(methyl)amino]methyl]phenyl]-methylphosphinic acid |
| SMILES | CCN(C)Cc1ccc(P(C)(=O)O)cc1 |
| InChI | InChI=1S/C11H18NO2P/c1-4-12(2)9-10-5-7-11(8-6-10)15(3,13)14/h5-8H,4,9H2,1-3H3,(H,13,14) |
| InChIKey | NKWRJOSPFYGFDP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|