C10H21N3+2 — CID 22890001
N,N-diethyl-2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethanamine (PubChem CID 22890001) has the molecular formula C10H21N3+2 and a molecular weight of 183.30 g/mol. Its IUPAC name is N,N-diethyl-2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethanamine |
|---|---|
| PubChem CID | 22890001 |
| Molecular Formula | C10H21N3+2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N,N-diethyl-2-(3-methyl-1H-imidazole-1,3-diium-1-yl)ethanamine |
| SMILES | CCN(CC)CC[NH+]1C=C[N+](C)=C1 |
| InChI | InChI=1S/C10H20N3/c1-4-12(5-2)8-9-13-7-6-11(3)10-13/h6-7,10H,4-5,8-9H2,1-3H3/q+1/p+1 |
| InChIKey | CTBFSZUKOQEBMY-UHFFFAOYSA-O |
| XLogP | -0.63 |
| TPSA | 10.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|