C39H30F6N2O3 — CID 22891464
N-(2,2,2-trifluoroethyl)-9-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]methoxy]ethyl]fluorene-9-carboxamide (PubChem CID 22891464) has the molecular formula C39H30F6N2O3 and a molecular weight of 688.67 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethyl)-9-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]methoxy]ethyl]fluorene-9-carboxamide.
| Compound Name | N-(2,2,2-trifluoroethyl)-9-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]methoxy]ethyl]fluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891464 |
| Molecular Formula | C39H30F6N2O3 |
| Molecular Weight | 688.67 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | N-(2,2,2-trifluoroethyl)-9-[2-[[4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]phenyl]methoxy]ethyl]fluorene-9-carboxamide |
| SMILES | O=C(Nc1ccc(COCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)cc1)c1ccccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C39H30F6N2O3/c40-38(41,42)24-46-36(49)37(33-11-5-3-8-30(33)31-9-4-6-12-34(31)37)21-22-50-23-25-13-19-28(20-14-25)47-35(48)32-10-2-1-7-29(32)26-15-17-27(18-16-26)39(43,44)45/h1-20H,21-24H2,(H,46,49)(H,47,48) |
| InChIKey | SXHYTNFPOYYRGK-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.67 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|