C8H9F3N2O2 — CID 22892837
N-[(E)-[(E)-4-oxo-2-(trifluoromethyl)pent-2-enylidene]amino]acetamide (PubChem CID 22892837) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is N-[(E)-[(E)-4-oxo-2-(trifluoromethyl)pent-2-enylidene]amino]acetamide.
| Compound Name | N-[(E)-[(E)-4-oxo-2-(trifluoromethyl)pent-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 22892837 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-[(E)-[(E)-4-oxo-2-(trifluoromethyl)pent-2-enylidene]amino]acetamide |
| SMILES | CC(=O)/C=C(\C=N\NC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2/c1-5(14)3-7(8(9,10)11)4-12-13-6(2)15/h3-4H,1-2H3,(H,13,15)/b7-3+,12-4+ |
| InChIKey | SNSHSIWRNBJTOR-ZUAGWBGVSA-N |
| XLogP | 1.19 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|