About 7-oxonon-8-enyl prop-2-enoate
7-oxonon-8-enyl prop-2-enoate (PubChem CID 22894397) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 7-oxonon-8-enyl prop-2-enoate.
Molecular Properties
| Compound Name | 7-oxonon-8-enyl prop-2-enoate |
| PubChem CID | 22894397 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 7-oxonon-8-enyl prop-2-enoate |
| SMILES | C=CC(=O)CCCCCCOC(=O)C=C |
| InChI | InChI=1S/C12H18O3/c1-3-11(13)9-7-5-6-8-10-15-12(14)4-2/h3-4H,1-2,5-10H2 |
| InChIKey | VUPMMCDUOAHIHJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-oxonon-8-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxonon-8-enyl prop-2-enoate?
The IUPAC name of 7-oxonon-8-enyl prop-2-enoate (CID 22894397) is 7-oxonon-8-enyl prop-2-enoate.
What is the SMILES notation for 7-oxonon-8-enyl prop-2-enoate?
The canonical SMILES for 7-oxonon-8-enyl prop-2-enoate is C=CC(=O)CCCCCCOC(=O)C=C.
What is the InChIKey of 7-oxonon-8-enyl prop-2-enoate?
The InChIKey is VUPMMCDUOAHIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-3-11(13)9-7-5-6-8-10-15-12(14)4-2/h3-4H,1-2,5-10H2.
What are the key properties of 7-oxonon-8-enyl prop-2-enoate?
7-oxonon-8-enyl prop-2-enoate has a molecular weight of 210.27 g/mol, XLogP of 2.42, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxonon-8-enyl prop-2-enoate is sourced from PubChem (CID 22894397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).