C24H19F4N9O6S2 — CID 22895435
2,2,3,3-tetrafluoro-4-oxo-4-[2-[4-[[3-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoylamino]phenyl]sulfonylamino]phenyl]hydrazinyl]butanoic acid (PubChem CID 22895435) has the molecular formula C24H19F4N9O6S2 and a molecular weight of 669.60 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-[2-[4-[[3-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoylamino]phenyl]sulfonylamino]phenyl]hydrazinyl]butanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-[2-[4-[[3-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoylamino]phenyl]sulfonylamino]phenyl]hydrazinyl]butanoic acid |
|---|---|
| PubChem CID | 22895435 |
| Molecular Formula | C24H19F4N9O6S2 |
| Molecular Weight | 669.60 g/mol |
| Exact Mass | 669.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-[2-[4-[[3-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoylamino]phenyl]sulfonylamino]phenyl]hydrazinyl]butanoic acid |
| SMILES | O=C(Nc1cccc(-n2[nH]nnc2=S)c1)Nc1cccc(S(=O)(=O)Nc2ccc(NNC(=O)C(F)(F)C(F)(F)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H19F4N9O6S2/c25-23(26,24(27,28)20(39)40)19(38)32-31-13-7-9-14(10-8-13)34-45(42,43)18-6-2-4-16(12-18)30-21(41)29-15-3-1-5-17(11-15)37-22(44)33-35-36-37/h1-12,31,34H,(H,32,38)(H,39,40)(H2,29,30,41)(H,33,36,44) |
| InChIKey | WPAQQNUZYPPJPU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 212.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|