C21H27NO5S — CID 22896377
2-ethoxyethyl [2-oxo-3-(2,4,6-trimethylphenyl)-7-thia-1-azaspiro[4.4]non-3-en-4-yl] carbonate (PubChem CID 22896377) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-ethoxyethyl [2-oxo-3-(2,4,6-trimethylphenyl)-7-thia-1-azaspiro[4.4]non-3-en-4-yl] carbonate.
| Compound Name | 2-ethoxyethyl [2-oxo-3-(2,4,6-trimethylphenyl)-7-thia-1-azaspiro[4.4]non-3-en-4-yl] carbonate |
|---|---|
| PubChem CID | 22896377 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-ethoxyethyl [2-oxo-3-(2,4,6-trimethylphenyl)-7-thia-1-azaspiro[4.4]non-3-en-4-yl] carbonate |
| SMILES | CCOCCOC(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)NC12CCSC2 |
| InChI | InChI=1S/C21H27NO5S/c1-5-25-7-8-26-20(24)27-18-17(16-14(3)10-13(2)11-15(16)4)19(23)22-21(18)6-9-28-12-21/h10-11H,5-9,12H2,1-4H3,(H,22,23) |
| InChIKey | NPHUNQAURRAKQY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|