C22H28N2O5 — CID 21134203
ethyl [8-methoxyimino-2-oxo-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-4-yl] carbonate (PubChem CID 21134203) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl [8-methoxyimino-2-oxo-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-4-yl] carbonate.
| Compound Name | ethyl [8-methoxyimino-2-oxo-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
|---|---|
| PubChem CID | 21134203 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | ethyl [8-methoxyimino-2-oxo-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-4-yl] carbonate |
| SMILES | CCOC(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)NC12CCC(=NOC)CC2 |
| InChI | InChI=1S/C22H28N2O5/c1-6-28-21(26)29-19-18(17-14(3)11-13(2)12-15(17)4)20(25)23-22(19)9-7-16(8-10-22)24-27-5/h11-12H,6-10H2,1-5H3,(H,23,25)/b24-16- |
| InChIKey | GMIIHKSNIDQWCT-JLPGSUDCSA-N |
| XLogP | 3.94 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|