C25H33NO5 — CID 59538258
[3-(2,6-diethyl-4-methylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] prop-2-enyl carbonate (PubChem CID 59538258) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is [3-(2,6-diethyl-4-methylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] prop-2-enyl carbonate.
| Compound Name | [3-(2,6-diethyl-4-methylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 59538258 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | [3-(2,6-diethyl-4-methylphenyl)-8-methoxy-2-oxo-1-azaspiro[4.5]dec-3-en-4-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=C(c2c(CC)cc(C)cc2CC)C(=O)NC12CCC(OC)CC2 |
| InChI | InChI=1S/C25H33NO5/c1-6-13-30-24(28)31-22-21(20-17(7-2)14-16(4)15-18(20)8-3)23(27)26-25(22)11-9-19(29-5)10-12-25/h6,14-15,19H,1,7-13H2,2-5H3,(H,26,27) |
| InChIKey | LTCHZSATKFZHJE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|