C23H33NO5 — CID 123592879
4-[ethoxy(hydroxy)methoxy]-8-(methoxymethyl)-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 123592879) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 4-[ethoxy(hydroxy)methoxy]-8-(methoxymethyl)-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-[ethoxy(hydroxy)methoxy]-8-(methoxymethyl)-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 123592879 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 4-[ethoxy(hydroxy)methoxy]-8-(methoxymethyl)-3-(2,4,6-trimethylphenyl)-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | CCOC(O)OC1=C(c2c(C)cc(C)cc2C)C(=O)NC12CCC(COC)CC2 |
| InChI | InChI=1S/C23H33NO5/c1-6-28-22(26)29-20-19(18-15(3)11-14(2)12-16(18)4)21(25)24-23(20)9-7-17(8-10-23)13-27-5/h11-12,17,22,26H,6-10,13H2,1-5H3,(H,24,25) |
| InChIKey | XQMNJVDBDLRJHT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|