C19H30N3O2+ — CID 2289724
N'-(4-ethylphenyl)-N-[4-[(3R)-piperidin-1-ium-3-yl]butyl]oxamide (PubChem CID 2289724) has the molecular formula C19H30N3O2+ and a molecular weight of 332.47 g/mol. Its IUPAC name is N'-(4-ethylphenyl)-N-[4-[(3R)-piperidin-1-ium-3-yl]butyl]oxamide.
| Compound Name | N'-(4-ethylphenyl)-N-[4-[(3R)-piperidin-1-ium-3-yl]butyl]oxamide |
|---|---|
| PubChem CID | 2289724 |
| Molecular Formula | C19H30N3O2+ |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | N'-(4-ethylphenyl)-N-[4-[(3R)-piperidin-1-ium-3-yl]butyl]oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCCCC[C@@H]2CCC[NH2+]C2)cc1 |
| InChI | InChI=1S/C19H29N3O2/c1-2-15-8-10-17(11-9-15)22-19(24)18(23)21-13-4-3-6-16-7-5-12-20-14-16/h8-11,16,20H,2-7,12-14H2,1H3,(H,21,23)(H,22,24)/p+1/t16-/m1/s1 |
| InChIKey | UXBIMYHPJJIFKY-MRXNPFEDSA-O |
| XLogP | 1.45 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|